About (2S)-2-phenylbutanedioic acid
(2S)-2-phenylbutanedioic acid (PubChem CID 139065900) has the molecular formula C20H20O8
and a molecular weight of 388.37 g/mol. Its IUPAC name is (2S)-2-phenylbutanedioic acid.
Molecular Properties
| Compound Name | (2S)-2-phenylbutanedioic acid |
| PubChem CID | 139065900 |
| Molecular Formula | C20H20O8 |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | (2S)-2-phenylbutanedioic acid |
| SMILES | O=C(O)C[C@H](C(=O)O)c1ccccc1.O=C(O)C[C@H](C(=O)O)c1ccccc1 |
| InChI | InChI=1S/2C10H10O4/c2*11-9(12)6-8(10(13)14)7-4-2-1-3-5-7/h2*1-5,8H,6H2,(H,11,12)(H,13,14)/t2*8-/m00/s1 |
| InChIKey | TWXYOBGAVRYWRI-GRHHLOCNSA-N |
| XLogP | 2.66 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-phenylbutanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-phenylbutanedioic acid?
The IUPAC name of (2S)-2-phenylbutanedioic acid (CID 139065900) is (2S)-2-phenylbutanedioic acid.
What is the SMILES notation for (2S)-2-phenylbutanedioic acid?
The canonical SMILES for (2S)-2-phenylbutanedioic acid is O=C(O)C[C@H](C(=O)O)c1ccccc1.O=C(O)C[C@H](C(=O)O)c1ccccc1.
What is the InChIKey of (2S)-2-phenylbutanedioic acid?
The InChIKey is TWXYOBGAVRYWRI-GRHHLOCNSA-N. The full InChI is InChI=1S/2C10H10O4/c2*11-9(12)6-8(10(13)14)7-4-2-1-3-5-7/h2*1-5,8H,6H2,(H,11,12)(H,13,14)/t2*8-/m00/s1.
What are the key properties of (2S)-2-phenylbutanedioic acid?
(2S)-2-phenylbutanedioic acid has a molecular weight of 388.37 g/mol, XLogP of 2.66, 8 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-phenylbutanedioic acid is sourced from PubChem (CID 139065900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).