C35H30Cl2N6NiO2 — CID 139066985
(NE,1Z)-4-chloro-N-[1-(5-chloro-2-oxidophenyl)ethylidene]benzenecarbohydrazonate;nickel(2+);tetrakis(pyridine) (PubChem CID 139066985) has the molecular formula C35H30Cl2N6NiO2 and a molecular weight of 696.26 g/mol. Its IUPAC name is (NE,1Z)-4-chloro-N-[1-(5-chloro-2-oxidophenyl)ethylidene]benzenecarbohydrazonate;nickel(2+);tetrakis(pyridine).
| Compound Name | (NE,1Z)-4-chloro-N-[1-(5-chloro-2-oxidophenyl)ethylidene]benzenecarbohydrazonate;nickel(2+);tetrakis(pyridine) |
|---|---|
| PubChem CID | 139066985 |
| Molecular Formula | C35H30Cl2N6NiO2 |
| Molecular Weight | 696.26 g/mol |
| Exact Mass | 694.12 |
| IUPAC Name | (NE,1Z)-4-chloro-N-[1-(5-chloro-2-oxidophenyl)ethylidene]benzenecarbohydrazonate;nickel(2+);tetrakis(pyridine) |
| SMILES | C/C(=N\N=C(/[O-])c1ccc(Cl)cc1)c1cc(Cl)ccc1[O-].[Ni+2].c1ccncc1.c1ccncc1.c1ccncc1.c1ccncc1 |
| InChI | InChI=1S/C15H12Cl2N2O2.4C5H5N.Ni/c1-9(13-8-12(17)6-7-14(13)20)18-19-15(21)10-2-4-11(16)5-3-10;4*1-2-4-6-5-3-1;/h2-8,20H,1H3,(H,19,21);4*1-5H;/q;;;;;+2/p-2/b18-9+;;;;; |
| InChIKey | BQLFYWIJCVZHLF-ORHDQSNNSA-L |
| XLogP | 6.92 |
| TPSA | 122.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.26 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|