C26H24Cl2N4NiO2+4 — CID 5036125
bis([4-chloro-2-(pyridin-2-ylmethyliminomethyl)phenyl]oxidanium);nickel(2+) (PubChem CID 5036125) has the molecular formula C26H24Cl2N4NiO2+4 and a molecular weight of 554.10 g/mol. Its IUPAC name is bis([4-chloro-2-(pyridin-2-ylmethyliminomethyl)phenyl]oxidanium);nickel(2+).
| Compound Name | bis([4-chloro-2-(pyridin-2-ylmethyliminomethyl)phenyl]oxidanium);nickel(2+) |
|---|---|
| PubChem CID | 5036125 |
| Molecular Formula | C26H24Cl2N4NiO2+4 |
| Molecular Weight | 554.10 g/mol |
| Exact Mass | 552.06 |
| IUPAC Name | bis([4-chloro-2-(pyridin-2-ylmethyliminomethyl)phenyl]oxidanium);nickel(2+) |
| SMILES | [Ni+2].[OH2+]c1ccc(Cl)cc1/C=N/Cc1ccccn1.[OH2+]c1ccc(Cl)cc1C=NCc1ccccn1 |
| InChI | InChI=1S/2C13H11ClN2O.Ni/c2*14-11-4-5-13(17)10(7-11)8-15-9-12-3-1-2-6-16-12;/h2*1-8,17H,9H2;/q;;+2/p+2/b15-8+;; |
| InChIKey | GPRZCPFZVAYXLI-OLIKVXRNSA-P |
| XLogP | 5.58 |
| TPSA | 96.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.10 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|