C24H27NO3 — CID 139068886
methyl (2S,3aR,6aS)-2-benzyl-6a-methyl-1-phenylmethoxy-3,4-dihydro-2H-cyclopenta[b]pyrrole-3a-carboxylate (PubChem CID 139068886) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is methyl (2S,3aR,6aS)-2-benzyl-6a-methyl-1-phenylmethoxy-3,4-dihydro-2H-cyclopenta[b]pyrrole-3a-carboxylate.
| Compound Name | methyl (2S,3aR,6aS)-2-benzyl-6a-methyl-1-phenylmethoxy-3,4-dihydro-2H-cyclopenta[b]pyrrole-3a-carboxylate |
|---|---|
| PubChem CID | 139068886 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | methyl (2S,3aR,6aS)-2-benzyl-6a-methyl-1-phenylmethoxy-3,4-dihydro-2H-cyclopenta[b]pyrrole-3a-carboxylate |
| SMILES | COC(=O)[C@@]12CC=C[C@]1(C)N(OCc1ccccc1)[C@@H](Cc1ccccc1)C2 |
| InChI | InChI=1S/C24H27NO3/c1-23-14-9-15-24(23,22(26)27-2)17-21(16-19-10-5-3-6-11-19)25(23)28-18-20-12-7-4-8-13-20/h3-14,21H,15-18H2,1-2H3/t21-,23-,24-/m0/s1 |
| InChIKey | LTMQTQGKCSYYCN-XWGVYQGASA-N |
| XLogP | 4.31 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|