C18H36N3+ — CID 139070204
1-undecyl-4,7-diaza-1-azoniatricyclo[5.2.1.04,10]decane (PubChem CID 139070204) has the molecular formula C18H36N3+ and a molecular weight of 294.51 g/mol. Its IUPAC name is 1-undecyl-4,7-diaza-1-azoniatricyclo[5.2.1.04,10]decane.
| Compound Name | 1-undecyl-4,7-diaza-1-azoniatricyclo[5.2.1.04,10]decane |
|---|---|
| PubChem CID | 139070204 |
| Molecular Formula | C18H36N3+ |
| Molecular Weight | 294.51 g/mol |
| Exact Mass | 294.29 |
| IUPAC Name | 1-undecyl-4,7-diaza-1-azoniatricyclo[5.2.1.04,10]decane |
| SMILES | CCCCCCCCCCC[N+]12CCN3CCN(CC1)C32 |
| InChI | InChI=1S/C18H36N3/c1-2-3-4-5-6-7-8-9-10-15-21-16-13-19-11-12-20(14-17-21)18(19)21/h18H,2-17H2,1H3/q+1 |
| InChIKey | AVAGNTBWOWFINC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|