About 4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium dinitrate
4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium dinitrate (PubChem CID 139070781) has the molecular formula C12H12N4O6
and a molecular weight of 308.25 g/mol. Its IUPAC name is 4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium dinitrate.
Molecular Properties
| Compound Name | 4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium dinitrate |
| PubChem CID | 139070781 |
| Molecular Formula | C12H12N4O6 |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium dinitrate |
| SMILES | C(=C/c1cc[nH+]cc1)\c1cc[nH+]cc1.O=[N+]([O-])[O-].O=[N+]([O-])[O-] |
| InChI | InChI=1S/C12H10N2.2NO3/c1(11-3-7-13-8-4-11)2-12-5-9-14-10-6-12;2*2-1(3)4/h1-10H;;/q;2*-1/p+2/b2-1+;; |
| InChIKey | CIJRVLLTTTZZRD-SEPHDYHBSA-P |
| XLogP | 1.01 |
| TPSA | 160.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium dinitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium dinitrate?
The IUPAC name of 4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium dinitrate (CID 139070781) is 4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium dinitrate.
What is the SMILES notation for 4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium dinitrate?
The canonical SMILES for 4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium dinitrate is C(=C/c1cc[nH+]cc1)\c1cc[nH+]cc1.O=[N+]([O-])[O-].O=[N+]([O-])[O-].
What is the InChIKey of 4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium dinitrate?
The InChIKey is CIJRVLLTTTZZRD-SEPHDYHBSA-P. The full InChI is InChI=1S/C12H10N2.2NO3/c1(11-3-7-13-8-4-11)2-12-5-9-14-10-6-12;2*2-1(3)4/h1-10H;;/q;2*-1/p+2/b2-1+;;.
What are the key properties of 4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium dinitrate?
4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium dinitrate has a molecular weight of 308.25 g/mol, XLogP of 1.01, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium dinitrate is sourced from PubChem (CID 139070781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).