C42H54N2O2 — CID 139071266
[(1R,3S)-3-[(dimethylamino)methyl]-2,2-dimethylcyclopropyl]-diphenylmethanol (PubChem CID 139071266) has the molecular formula C42H54N2O2 and a molecular weight of 618.91 g/mol. Its IUPAC name is [(1R,3S)-3-[(dimethylamino)methyl]-2,2-dimethylcyclopropyl]-diphenylmethanol.
| Compound Name | [(1R,3S)-3-[(dimethylamino)methyl]-2,2-dimethylcyclopropyl]-diphenylmethanol |
|---|---|
| PubChem CID | 139071266 |
| Molecular Formula | C42H54N2O2 |
| Molecular Weight | 618.91 g/mol |
| Exact Mass | 618.42 |
| IUPAC Name | [(1R,3S)-3-[(dimethylamino)methyl]-2,2-dimethylcyclopropyl]-diphenylmethanol |
| SMILES | CN(C)C[C@H]1[C@@H](C(O)(c2ccccc2)c2ccccc2)C1(C)C.CN(C)C[C@H]1[C@@H](C(O)(c2ccccc2)c2ccccc2)C1(C)C |
| InChI | InChI=1S/2C21H27NO/c2*1-20(2)18(15-22(3)4)19(20)21(23,16-11-7-5-8-12-16)17-13-9-6-10-14-17/h2*5-14,18-19,23H,15H2,1-4H3/t2*18-,19+/m00/s1 |
| InChIKey | QNZDEUUXGXBLDM-UYBUCJAWSA-N |
| XLogP | 7.51 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.91 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |