C38H31N3O7 — CID 139071279
3-carboxy-1-[(3-carboxy-2-hydroxynaphthalen-1-yl)methyl]naphthalen-2-olate;N,N-dimethylformamide;1,10-phenanthrolin-10-ium (PubChem CID 139071279) has the molecular formula C38H31N3O7 and a molecular weight of 641.68 g/mol. Its IUPAC name is 3-carboxy-1-[(3-carboxy-2-hydroxynaphthalen-1-yl)methyl]naphthalen-2-olate;N,N-dimethylformamide;1,10-phenanthrolin-10-ium.
| Compound Name | 3-carboxy-1-[(3-carboxy-2-hydroxynaphthalen-1-yl)methyl]naphthalen-2-olate;N,N-dimethylformamide;1,10-phenanthrolin-10-ium |
|---|---|
| PubChem CID | 139071279 |
| Molecular Formula | C38H31N3O7 |
| Molecular Weight | 641.68 g/mol |
| Exact Mass | 641.22 |
| IUPAC Name | 3-carboxy-1-[(3-carboxy-2-hydroxynaphthalen-1-yl)methyl]naphthalen-2-olate;N,N-dimethylformamide;1,10-phenanthrolin-10-ium |
| SMILES | CN(C)C=O.O=C(O)c1cc2ccccc2c(Cc2c(O)c(C(=O)O)cc3ccccc23)c1[O-].c1cnc2c(c1)ccc1ccc[nH+]c12 |
| InChI | InChI=1S/C23H16O6.C12H8N2.C3H7NO/c24-20-16(14-7-3-1-5-12(14)9-18(20)22(26)27)11-17-15-8-4-2-6-13(15)10-19(21(17)25)23(28)29;1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;1-4(2)3-5/h1-10,24-25H,11H2,(H,26,27)(H,28,29);1-8H;3H,1-2H3 |
| InChIKey | PHHQHCNNJNKIGW-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 165.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.68 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|