C8H7N5O3S — CID 139071561
5-[(5-methyl-1,3-thiazol-2-yl)diazenyl]-1,3-diazinane-2,4,6-trione (PubChem CID 139071561) has the molecular formula C8H7N5O3S and a molecular weight of 253.24 g/mol. Its IUPAC name is 5-[(5-methyl-1,3-thiazol-2-yl)diazenyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(5-methyl-1,3-thiazol-2-yl)diazenyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 139071561 |
| Molecular Formula | C8H7N5O3S |
| Molecular Weight | 253.24 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 5-[(5-methyl-1,3-thiazol-2-yl)diazenyl]-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1cnc(/N=N/C2C(=O)NC(=O)NC2=O)s1 |
| InChI | InChI=1S/C8H7N5O3S/c1-3-2-9-8(17-3)13-12-4-5(14)10-7(16)11-6(4)15/h2,4H,1H3,(H2,10,11,14,15,16)/b13-12+ |
| InChIKey | AAMFVTSCXZMSCY-OUKQBFOZSA-N |
| XLogP | 0.27 |
| TPSA | 112.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.24 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|