C22H27ClN2O2 — CID 139071779
ethyl (2R,3S)-3-(2-chloro-6,7-dimethylquinolin-3-yl)-1-cyclohexylaziridine-2-carboxylate (PubChem CID 139071779) has the molecular formula C22H27ClN2O2 and a molecular weight of 386.92 g/mol. Its IUPAC name is ethyl (2R,3S)-3-(2-chloro-6,7-dimethylquinolin-3-yl)-1-cyclohexylaziridine-2-carboxylate.
| Compound Name | ethyl (2R,3S)-3-(2-chloro-6,7-dimethylquinolin-3-yl)-1-cyclohexylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 139071779 |
| Molecular Formula | C22H27ClN2O2 |
| Molecular Weight | 386.92 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | ethyl (2R,3S)-3-(2-chloro-6,7-dimethylquinolin-3-yl)-1-cyclohexylaziridine-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H](c2cc3cc(C)c(C)cc3nc2Cl)N1C1CCCCC1 |
| InChI | InChI=1S/C22H27ClN2O2/c1-4-27-22(26)20-19(25(20)16-8-6-5-7-9-16)17-12-15-10-13(2)14(3)11-18(15)24-21(17)23/h10-12,16,19-20H,4-9H2,1-3H3/t19-,20+,25?/m0/s1 |
| InChIKey | ZVUKCEBVVVLPEY-KYWQPSMRSA-N |
| XLogP | 5.13 |
| TPSA | 42.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.92 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|