C22H40N4O6 — CID 139071952
tert-butyl N-[(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl]carbamate (PubChem CID 139071952) has the molecular formula C22H40N4O6 and a molecular weight of 456.58 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 139071952 |
| Molecular Formula | C22H40N4O6 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.29 |
| IUPAC Name | tert-butyl N-[(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl]carbamate |
| SMILES | C=CCNC(=O)[C@H](C)NC(=O)OC(C)(C)C.C=CCNC(=O)[C@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/2C11H20N2O3/c2*1-6-7-12-9(14)8(2)13-10(15)16-11(3,4)5/h2*6,8H,1,7H2,2-5H3,(H,12,14)(H,13,15)/t2*8-/m00/s1 |
| InChIKey | ZCKRLTBLDQGVLX-GRHHLOCNSA-N |
| XLogP | 2.40 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|