C11H19N3O6 — CID 139072263
piperazine-1,4-diium;pyridine-2,5-dicarboxylate;dihydrate (PubChem CID 139072263) has the molecular formula C11H19N3O6 and a molecular weight of 289.29 g/mol. Its IUPAC name is piperazine-1,4-diium;pyridine-2,5-dicarboxylate;dihydrate.
| Compound Name | piperazine-1,4-diium;pyridine-2,5-dicarboxylate;dihydrate |
|---|---|
| PubChem CID | 139072263 |
| Molecular Formula | C11H19N3O6 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | piperazine-1,4-diium;pyridine-2,5-dicarboxylate;dihydrate |
| SMILES | C1C[NH2+]CC[NH2+]1.O.O.O=C([O-])c1ccc(C(=O)[O-])nc1 |
| InChI | InChI=1S/C7H5NO4.C4H10N2.2H2O/c9-6(10)4-1-2-5(7(11)12)8-3-4;1-2-6-4-3-5-1;;/h1-3H,(H,9,10)(H,11,12);5-6H,1-4H2;2*1H2 |
| InChIKey | BCBDLAPAVZBKRV-UHFFFAOYSA-N |
| XLogP | -6.71 |
| TPSA | 189.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | -6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |