C14H5F4NO3 — CID 139073309
4,5,6,7-tetrafluoro-2-(2-hydroxyphenyl)isoindole-1,3-dione (PubChem CID 139073309) has the molecular formula C14H5F4NO3 and a molecular weight of 311.19 g/mol. Its IUPAC name is 4,5,6,7-tetrafluoro-2-(2-hydroxyphenyl)isoindole-1,3-dione.
| Compound Name | 4,5,6,7-tetrafluoro-2-(2-hydroxyphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 139073309 |
| Molecular Formula | C14H5F4NO3 |
| Molecular Weight | 311.19 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | 4,5,6,7-tetrafluoro-2-(2-hydroxyphenyl)isoindole-1,3-dione |
| SMILES | O=C1c2c(F)c(F)c(F)c(F)c2C(=O)N1c1ccccc1O |
| InChI | InChI=1S/C14H5F4NO3/c15-9-7-8(10(16)12(18)11(9)17)14(22)19(13(7)21)5-3-1-2-4-6(5)20/h1-4,20H |
| InChIKey | GHNYPJSGSRLYPM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.19 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|