C24H28N6O2 — CID 139073768
3,9-diethyl-12,13-diphenyl-1,3,5,7,9,11-hexazatetracyclo[9.2.1.05,13.07,12]tetradecane-6,14-dione (PubChem CID 139073768) has the molecular formula C24H28N6O2 and a molecular weight of 432.53 g/mol. Its IUPAC name is 3,9-diethyl-12,13-diphenyl-1,3,5,7,9,11-hexazatetracyclo[9.2.1.05,13.07,12]tetradecane-6,14-dione.
| Compound Name | 3,9-diethyl-12,13-diphenyl-1,3,5,7,9,11-hexazatetracyclo[9.2.1.05,13.07,12]tetradecane-6,14-dione |
|---|---|
| PubChem CID | 139073768 |
| Molecular Formula | C24H28N6O2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 3,9-diethyl-12,13-diphenyl-1,3,5,7,9,11-hexazatetracyclo[9.2.1.05,13.07,12]tetradecane-6,14-dione |
| SMILES | CCN1CN2C(=O)N3CN(CC)CN4C(=O)N(C1)C2(c1ccccc1)C34c1ccccc1 |
| InChI | InChI=1S/C24H28N6O2/c1-3-25-15-27-21(31)29-17-26(4-2)18-30-22(32)28(16-25)23(27,19-11-7-5-8-12-19)24(29,30)20-13-9-6-10-14-20/h5-14H,3-4,15-18H2,1-2H3 |
| InChIKey | PAIMGKZXCOAGJZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 53.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |