C22H24N6O2 — CID 1275573
3,9-dibenzyl-1,3,5,7,9,11-hexazatetracyclo[9.2.1.05,13.07,12]tetradecane-6,14-dione (PubChem CID 1275573) has the molecular formula C22H24N6O2 and a molecular weight of 404.47 g/mol. Its IUPAC name is 3,9-dibenzyl-1,3,5,7,9,11-hexazatetracyclo[9.2.1.05,13.07,12]tetradecane-6,14-dione.
| Compound Name | 3,9-dibenzyl-1,3,5,7,9,11-hexazatetracyclo[9.2.1.05,13.07,12]tetradecane-6,14-dione |
|---|---|
| PubChem CID | 1275573 |
| Molecular Formula | C22H24N6O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 3,9-dibenzyl-1,3,5,7,9,11-hexazatetracyclo[9.2.1.05,13.07,12]tetradecane-6,14-dione |
| SMILES | O=C1N2CN(Cc3ccccc3)CN3C(=O)N4CN(Cc5ccccc5)CN1C4C23 |
| InChI | InChI=1S/C22H24N6O2/c29-21-25-13-23(11-17-7-3-1-4-8-17)14-26-19(25)20-27(21)15-24(16-28(20)22(26)30)12-18-9-5-2-6-10-18/h1-10,19-20H,11-16H2 |
| InChIKey | OFQHYDRPBVHPTH-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 53.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |