C46H40N6O2 — CID 139068844
3,9-dibenzhydryl-12,13-diphenyl-1,3,5,7,9,11-hexazatetracyclo[9.2.1.05,13.07,12]tetradecane-6,14-dione (PubChem CID 139068844) has the molecular formula C46H40N6O2 and a molecular weight of 708.87 g/mol. Its IUPAC name is 3,9-dibenzhydryl-12,13-diphenyl-1,3,5,7,9,11-hexazatetracyclo[9.2.1.05,13.07,12]tetradecane-6,14-dione.
| Compound Name | 3,9-dibenzhydryl-12,13-diphenyl-1,3,5,7,9,11-hexazatetracyclo[9.2.1.05,13.07,12]tetradecane-6,14-dione |
|---|---|
| PubChem CID | 139068844 |
| Molecular Formula | C46H40N6O2 |
| Molecular Weight | 708.87 g/mol |
| Exact Mass | 708.32 |
| IUPAC Name | 3,9-dibenzhydryl-12,13-diphenyl-1,3,5,7,9,11-hexazatetracyclo[9.2.1.05,13.07,12]tetradecane-6,14-dione |
| SMILES | O=C1N2CN(C(c3ccccc3)c3ccccc3)CN3C(=O)N4CN(C(c5ccccc5)c5ccccc5)CN1C4(c1ccccc1)C23c1ccccc1 |
| InChI | InChI=1S/C46H40N6O2/c53-43-49-31-47(41(35-19-7-1-8-20-35)36-21-9-2-10-22-36)32-50-44(54)52-34-48(42(37-23-11-3-12-24-37)38-25-13-4-14-26-38)33-51(43)46(52,40-29-17-6-18-30-40)45(49,50)39-27-15-5-16-28-39/h1-30,41-42H,31-34H2 |
| InChIKey | ZRQRQKSOEGDIPY-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 53.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.87 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |