C34H46N2NiO4 — CID 139074053
nickel(2+);1,10-phenanthroline;bis((Z)-2,2,6,6-tetramethyl-5-oxohept-3-en-3-olate) (PubChem CID 139074053) has the molecular formula C34H46N2NiO4 and a molecular weight of 605.45 g/mol. Its IUPAC name is nickel(2+);1,10-phenanthroline;bis((Z)-2,2,6,6-tetramethyl-5-oxohept-3-en-3-olate).
| Compound Name | nickel(2+);1,10-phenanthroline;bis((Z)-2,2,6,6-tetramethyl-5-oxohept-3-en-3-olate) |
|---|---|
| PubChem CID | 139074053 |
| Molecular Formula | C34H46N2NiO4 |
| Molecular Weight | 605.45 g/mol |
| Exact Mass | 604.28 |
| IUPAC Name | nickel(2+);1,10-phenanthroline;bis((Z)-2,2,6,6-tetramethyl-5-oxohept-3-en-3-olate) |
| SMILES | CC(C)(C)C(=O)/C=C(\[O-])C(C)(C)C.CC(C)(C)C(=O)/C=C(\[O-])C(C)(C)C.[Ni+2].c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.2C11H20O2.Ni/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;2*1-10(2,3)8(12)7-9(13)11(4,5)6;/h1-8H;2*7,12H,1-6H3;/q;;;+2/p-2/b;2*8-7-; |
| InChIKey | DRPSYICXFWFUMA-CSYVZJGJSA-L |
| XLogP | 6.56 |
| TPSA | 106.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.45 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|