C18H20N4O8 — CID 139074095
bis(2-carboxypyridine-3-carboxylate);piperazine-1,4-diium (PubChem CID 139074095) has the molecular formula C18H20N4O8 and a molecular weight of 420.38 g/mol. Its IUPAC name is bis(2-carboxypyridine-3-carboxylate);piperazine-1,4-diium.
| Compound Name | bis(2-carboxypyridine-3-carboxylate);piperazine-1,4-diium |
|---|---|
| PubChem CID | 139074095 |
| Molecular Formula | C18H20N4O8 |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | bis(2-carboxypyridine-3-carboxylate);piperazine-1,4-diium |
| SMILES | C1C[NH2+]CC[NH2+]1.O=C([O-])c1cccnc1C(=O)O.O=C([O-])c1cccnc1C(=O)O |
| InChI | InChI=1S/2C7H5NO4.C4H10N2/c2*9-6(10)4-2-1-3-8-5(4)7(11)12;1-2-6-4-3-5-1/h2*1-3H,(H,9,10)(H,11,12);5-6H,1-4H2 |
| InChIKey | YGOPJYWJJSGRFH-UHFFFAOYSA-N |
| XLogP | -4.59 |
| TPSA | 213.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | -4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |