C21H25ClN2O — CID 139075875
(2S)-N-[(E)-1-(4-chlorophenyl)ethylideneamino]-2-[4-(2-methylpropyl)phenyl]propanamide (PubChem CID 139075875) has the molecular formula C21H25ClN2O and a molecular weight of 356.90 g/mol. Its IUPAC name is (2S)-N-[(E)-1-(4-chlorophenyl)ethylideneamino]-2-[4-(2-methylpropyl)phenyl]propanamide.
| Compound Name | (2S)-N-[(E)-1-(4-chlorophenyl)ethylideneamino]-2-[4-(2-methylpropyl)phenyl]propanamide |
|---|---|
| PubChem CID | 139075875 |
| Molecular Formula | C21H25ClN2O |
| Molecular Weight | 356.90 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | (2S)-N-[(E)-1-(4-chlorophenyl)ethylideneamino]-2-[4-(2-methylpropyl)phenyl]propanamide |
| SMILES | C/C(=N\NC(=O)[C@@H](C)c1ccc(CC(C)C)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H25ClN2O/c1-14(2)13-17-5-7-18(8-6-17)15(3)21(25)24-23-16(4)19-9-11-20(22)12-10-19/h5-12,14-15H,13H2,1-4H3,(H,24,25)/b23-16+/t15-/m0/s1 |
| InChIKey | NDHCXNJGOAUSRD-IXSYQRGLSA-N |
| XLogP | 5.18 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.90 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|