C18H21NO2S2 — CID 139076385
(3E,5E)-1-methyl-3,5-bis[(3-methylthiophen-2-yl)methylidene]piperidin-4-one;hydrate (PubChem CID 139076385) has the molecular formula C18H21NO2S2 and a molecular weight of 347.51 g/mol. Its IUPAC name is (3E,5E)-1-methyl-3,5-bis[(3-methylthiophen-2-yl)methylidene]piperidin-4-one;hydrate.
| Compound Name | (3E,5E)-1-methyl-3,5-bis[(3-methylthiophen-2-yl)methylidene]piperidin-4-one;hydrate |
|---|---|
| PubChem CID | 139076385 |
| Molecular Formula | C18H21NO2S2 |
| Molecular Weight | 347.51 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | (3E,5E)-1-methyl-3,5-bis[(3-methylthiophen-2-yl)methylidene]piperidin-4-one;hydrate |
| SMILES | Cc1ccsc1/C=C1\CN(C)C/C(=C\c2sccc2C)C1=O.O |
| InChI | InChI=1S/C18H19NOS2.H2O/c1-12-4-6-21-16(12)8-14-10-19(3)11-15(18(14)20)9-17-13(2)5-7-22-17;/h4-9H,10-11H2,1-3H3;1H2/b14-8+,15-9+; |
| InChIKey | YHDOLUYMUSHXMQ-XAYJRMPLSA-N |
| XLogP | 3.58 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|