C16H20O5S6 — CID 139076442
methyl 2-(5,8,11-trioxa-2,14,16,18-tetrathiabicyclo[13.3.0]octadec-1(15)-en-17-ylidene)-1,3-dithiole-4-carboxylate (PubChem CID 139076442) has the molecular formula C16H20O5S6 and a molecular weight of 484.73 g/mol. Its IUPAC name is methyl 2-(5,8,11-trioxa-2,14,16,18-tetrathiabicyclo[13.3.0]octadec-1(15)-en-17-ylidene)-1,3-dithiole-4-carboxylate.
| Compound Name | methyl 2-(5,8,11-trioxa-2,14,16,18-tetrathiabicyclo[13.3.0]octadec-1(15)-en-17-ylidene)-1,3-dithiole-4-carboxylate |
|---|---|
| PubChem CID | 139076442 |
| Molecular Formula | C16H20O5S6 |
| Molecular Weight | 484.73 g/mol |
| Exact Mass | 483.96 |
| IUPAC Name | methyl 2-(5,8,11-trioxa-2,14,16,18-tetrathiabicyclo[13.3.0]octadec-1(15)-en-17-ylidene)-1,3-dithiole-4-carboxylate |
| SMILES | COC(=O)C1=CSC(=C2SC3=C(SCCOCCOCCOCCS3)S2)S1 |
| InChI | InChI=1S/C16H20O5S6/c1-18-12(17)11-10-24-15(25-11)16-26-13-14(27-16)23-9-7-21-5-3-19-2-4-20-6-8-22-13/h10H,2-9H2,1H3 |
| InChIKey | CRWCFRDRIHKUIE-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.73 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |