C11H18N4O4 — CID 139080615
2-(2-azaniumylethylamino)ethylazanium;pyridine-2,5-dicarboxylate (PubChem CID 139080615) has the molecular formula C11H18N4O4 and a molecular weight of 270.29 g/mol. Its IUPAC name is 2-(2-azaniumylethylamino)ethylazanium;pyridine-2,5-dicarboxylate.
| Compound Name | 2-(2-azaniumylethylamino)ethylazanium;pyridine-2,5-dicarboxylate |
|---|---|
| PubChem CID | 139080615 |
| Molecular Formula | C11H18N4O4 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 2-(2-azaniumylethylamino)ethylazanium;pyridine-2,5-dicarboxylate |
| SMILES | O=C([O-])c1ccc(C(=O)[O-])nc1.[NH3+]CCNCC[NH3+] |
| InChI | InChI=1S/C7H5NO4.C4H13N3/c9-6(10)4-1-2-5(7(11)12)8-3-4;5-1-3-7-4-2-6/h1-3H,(H,9,10)(H,11,12);7H,1-6H2 |
| InChIKey | OLEGMBQXFZNKHF-UHFFFAOYSA-N |
| XLogP | -5.13 |
| TPSA | 160.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | -5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|