C22H11BrF12N2NiO4 — CID 139080948
N-(4-bromophenyl)-1-pyridin-2-ylmethanimine;bis((Z)-1,1,1,5,5,5-hexafluoro-4-oxopent-2-en-2-olate);nickel(2+) (PubChem CID 139080948) has the molecular formula C22H11BrF12N2NiO4 and a molecular weight of 733.91 g/mol. Its IUPAC name is N-(4-bromophenyl)-1-pyridin-2-ylmethanimine;bis((Z)-1,1,1,5,5,5-hexafluoro-4-oxopent-2-en-2-olate);nickel(2+).
| Compound Name | N-(4-bromophenyl)-1-pyridin-2-ylmethanimine;bis((Z)-1,1,1,5,5,5-hexafluoro-4-oxopent-2-en-2-olate);nickel(2+) |
|---|---|
| PubChem CID | 139080948 |
| Molecular Formula | C22H11BrF12N2NiO4 |
| Molecular Weight | 733.91 g/mol |
| Exact Mass | 731.91 |
| IUPAC Name | N-(4-bromophenyl)-1-pyridin-2-ylmethanimine;bis((Z)-1,1,1,5,5,5-hexafluoro-4-oxopent-2-en-2-olate);nickel(2+) |
| SMILES | Brc1ccc(/N=C/c2ccccn2)cc1.O=C(/C=C(\[O-])C(F)(F)F)C(F)(F)F.O=C(/C=C(\[O-])C(F)(F)F)C(F)(F)F.[Ni+2] |
| InChI | InChI=1S/C12H9BrN2.2C5H2F6O2.Ni/c13-10-4-6-11(7-5-10)15-9-12-3-1-2-8-14-12;2*6-4(7,8)2(12)1-3(13)5(9,10)11;/h1-9H;2*1,12H;/q;;;+2/p-2/b15-9+;2*2-1-; |
| InChIKey | QXCILCFANDJCMC-YRMTXFDESA-L |
| XLogP | 5.44 |
| TPSA | 105.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.91 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|