C20H24N2S2 — CID 139081227
(3-methylphenyl)methyl N-[(E)-1-phenylpentylideneamino]carbamodithioate (PubChem CID 139081227) has the molecular formula C20H24N2S2 and a molecular weight of 356.56 g/mol. Its IUPAC name is (3-methylphenyl)methyl N-[(E)-1-phenylpentylideneamino]carbamodithioate.
| Compound Name | (3-methylphenyl)methyl N-[(E)-1-phenylpentylideneamino]carbamodithioate |
|---|---|
| PubChem CID | 139081227 |
| Molecular Formula | C20H24N2S2 |
| Molecular Weight | 356.56 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | (3-methylphenyl)methyl N-[(E)-1-phenylpentylideneamino]carbamodithioate |
| SMILES | CCCC/C(=N\NC(=S)SCc1cccc(C)c1)c1ccccc1 |
| InChI | InChI=1S/C20H24N2S2/c1-3-4-13-19(18-11-6-5-7-12-18)21-22-20(23)24-15-17-10-8-9-16(2)14-17/h5-12,14H,3-4,13,15H2,1-2H3,(H,22,23)/b21-19+ |
| InChIKey | ZIHCWRMRMOBBPB-XUTLUUPISA-N |
| XLogP | 5.70 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.56 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|