C24H18F4N6O2 — CID 139082217
(2,4-difluorophenyl)-[1-(1,2,4-triazol-1-yl)cyclopropyl]methanone (PubChem CID 139082217) has the molecular formula C24H18F4N6O2 and a molecular weight of 498.44 g/mol. Its IUPAC name is (2,4-difluorophenyl)-[1-(1,2,4-triazol-1-yl)cyclopropyl]methanone.
| Compound Name | (2,4-difluorophenyl)-[1-(1,2,4-triazol-1-yl)cyclopropyl]methanone |
|---|---|
| PubChem CID | 139082217 |
| Molecular Formula | C24H18F4N6O2 |
| Molecular Weight | 498.44 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | (2,4-difluorophenyl)-[1-(1,2,4-triazol-1-yl)cyclopropyl]methanone |
| SMILES | O=C(c1ccc(F)cc1F)C1(n2cncn2)CC1.O=C(c1ccc(F)cc1F)C1(n2cncn2)CC1 |
| InChI | InChI=1S/2C12H9F2N3O/c2*13-8-1-2-9(10(14)5-8)11(18)12(3-4-12)17-7-15-6-16-17/h2*1-2,5-7H,3-4H2 |
| InChIKey | UWLSZJJSBJNKHG-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 95.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |