C15H15F2NO3 — CID 166415252
1-[4-(2,4-difluorobenzoyl)-4-hydroxypiperidin-1-yl]prop-2-en-1-one (PubChem CID 166415252) has the molecular formula C15H15F2NO3 and a molecular weight of 295.29 g/mol. Its IUPAC name is 1-[4-(2,4-difluorobenzoyl)-4-hydroxypiperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-(2,4-difluorobenzoyl)-4-hydroxypiperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166415252 |
| Molecular Formula | C15H15F2NO3 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 1-[4-(2,4-difluorobenzoyl)-4-hydroxypiperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(O)(C(=O)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C15H15F2NO3/c1-2-13(19)18-7-5-15(21,6-8-18)14(20)11-4-3-10(16)9-12(11)17/h2-4,9,21H,1,5-8H2 |
| InChIKey | SUINPGZMWRLBIV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|