About bis[4-fluoro-2-[1-(1,2,4-triazol-1-yl)cyclopropyl]phenyl]methanone
bis[4-fluoro-2-[1-(1,2,4-triazol-1-yl)cyclopropyl]phenyl]methanone (PubChem CID 70387165) has the molecular formula C23H18F2N6O
and a molecular weight of 432.43 g/mol. Its IUPAC name is bis[4-fluoro-2-[1-(1,2,4-triazol-1-yl)cyclopropyl]phenyl]methanone.
Molecular Properties
| Compound Name | bis[4-fluoro-2-[1-(1,2,4-triazol-1-yl)cyclopropyl]phenyl]methanone |
| PubChem CID | 70387165 |
| Molecular Formula | C23H18F2N6O |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | bis[4-fluoro-2-[1-(1,2,4-triazol-1-yl)cyclopropyl]phenyl]methanone |
| SMILES | O=C(c1ccc(F)cc1C1(n2cncn2)CC1)c1ccc(F)cc1C1(n2cncn2)CC1 |
| InChI | InChI=1S/C23H18F2N6O/c24-15-1-3-17(19(9-15)22(5-6-22)30-13-26-11-28-30)21(32)18-4-2-16(25)10-20(18)23(7-8-23)31-14-27-12-29-31/h1-4,9-14H,5-8H2 |
| InChIKey | RLTVGBGFPVKAJI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 78.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze bis[4-fluoro-2-[1-(1,2,4-triazol-1-yl)cyclopropyl]phenyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[4-fluoro-2-[1-(1,2,4-triazol-1-yl)cyclopropyl]phenyl]methanone?
The IUPAC name of bis[4-fluoro-2-[1-(1,2,4-triazol-1-yl)cyclopropyl]phenyl]methanone (CID 70387165) is bis[4-fluoro-2-[1-(1,2,4-triazol-1-yl)cyclopropyl]phenyl]methanone.
What is the SMILES notation for bis[4-fluoro-2-[1-(1,2,4-triazol-1-yl)cyclopropyl]phenyl]methanone?
The canonical SMILES for bis[4-fluoro-2-[1-(1,2,4-triazol-1-yl)cyclopropyl]phenyl]methanone is O=C(c1ccc(F)cc1C1(n2cncn2)CC1)c1ccc(F)cc1C1(n2cncn2)CC1.
What is the InChIKey of bis[4-fluoro-2-[1-(1,2,4-triazol-1-yl)cyclopropyl]phenyl]methanone?
The InChIKey is RLTVGBGFPVKAJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18F2N6O/c24-15-1-3-17(19(9-15)22(5-6-22)30-13-26-11-28-30)21(32)18-4-2-16(25)10-20(18)23(7-8-23)31-14-27-12-29-31/h1-4,9-14H,5-8H2.
What are the key properties of bis[4-fluoro-2-[1-(1,2,4-triazol-1-yl)cyclopropyl]phenyl]methanone?
bis[4-fluoro-2-[1-(1,2,4-triazol-1-yl)cyclopropyl]phenyl]methanone has a molecular weight of 432.43 g/mol, XLogP of 3.45, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis[4-fluoro-2-[1-(1,2,4-triazol-1-yl)cyclopropyl]phenyl]methanone is sourced from PubChem (CID 70387165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).