C18H17N3O2Se — CID 139083082
5-[(1S,2R)-2-nitro-1-phenylbutyl]-4-phenylselenadiazole (PubChem CID 139083082) has the molecular formula C18H17N3O2Se and a molecular weight of 386.31 g/mol. Its IUPAC name is 5-[(1S,2R)-2-nitro-1-phenylbutyl]-4-phenylselenadiazole.
| Compound Name | 5-[(1S,2R)-2-nitro-1-phenylbutyl]-4-phenylselenadiazole |
|---|---|
| PubChem CID | 139083082 |
| Molecular Formula | C18H17N3O2Se |
| Molecular Weight | 386.31 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | 5-[(1S,2R)-2-nitro-1-phenylbutyl]-4-phenylselenadiazole |
| SMILES | CC[C@H]([C@H](c1ccccc1)c1[se]nnc1-c1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C18H17N3O2Se/c1-2-15(21(22)23)16(13-9-5-3-6-10-13)18-17(19-20-24-18)14-11-7-4-8-12-14/h3-12,15-16H,2H2,1H3/t15-,16+/m1/s1 |
| InChIKey | VUHRNISQDAFTAM-CVEARBPZSA-N |
| XLogP | 3.39 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.31 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|