C19H19N3O2Se — CID 139085247
5-[(1S,2R)-1-(4-methylphenyl)-2-nitrobutyl]-4-phenylselenadiazole (PubChem CID 139085247) has the molecular formula C19H19N3O2Se and a molecular weight of 400.34 g/mol. Its IUPAC name is 5-[(1S,2R)-1-(4-methylphenyl)-2-nitrobutyl]-4-phenylselenadiazole.
| Compound Name | 5-[(1S,2R)-1-(4-methylphenyl)-2-nitrobutyl]-4-phenylselenadiazole |
|---|---|
| PubChem CID | 139085247 |
| Molecular Formula | C19H19N3O2Se |
| Molecular Weight | 400.34 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | 5-[(1S,2R)-1-(4-methylphenyl)-2-nitrobutyl]-4-phenylselenadiazole |
| SMILES | CC[C@H]([C@H](c1ccc(C)cc1)c1[se]nnc1-c1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C19H19N3O2Se/c1-3-16(22(23)24)17(14-11-9-13(2)10-12-14)19-18(20-21-25-19)15-7-5-4-6-8-15/h4-12,16-17H,3H2,1-2H3/t16-,17+/m1/s1 |
| InChIKey | CEFVVUOUSORKPU-SJORKVTESA-N |
| XLogP | 3.70 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|