C22H26N2Se — CID 134881671
4,5-bis(4-tert-butylphenyl)selenadiazole (PubChem CID 134881671) has the molecular formula C22H26N2Se and a molecular weight of 397.42 g/mol. Its IUPAC name is 4,5-bis(4-tert-butylphenyl)selenadiazole.
| Compound Name | 4,5-bis(4-tert-butylphenyl)selenadiazole |
|---|---|
| PubChem CID | 134881671 |
| Molecular Formula | C22H26N2Se |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 4,5-bis(4-tert-butylphenyl)selenadiazole |
| SMILES | CC(C)(C)c1ccc(-c2nn[se]c2-c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H26N2Se/c1-21(2,3)17-11-7-15(8-12-17)19-20(25-24-23-19)16-9-13-18(14-10-16)22(4,5)6/h7-14H,1-6H3 |
| InChIKey | MOCVVQGQVRYSHR-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|