About 4,5-diphenylselenadiazole
4,5-diphenylselenadiazole (PubChem CID 11161930) has the molecular formula C14H10N2Se
and a molecular weight of 285.21 g/mol. Its IUPAC name is 4,5-diphenylselenadiazole.
Molecular Properties
| Compound Name | 4,5-diphenylselenadiazole |
| PubChem CID | 11161930 |
| Molecular Formula | C14H10N2Se |
| Molecular Weight | 285.21 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | 4,5-diphenylselenadiazole |
| SMILES | c1ccc(-c2nn[se]c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C14H10N2Se/c1-3-7-11(8-4-1)13-14(17-16-15-13)12-9-5-2-6-10-12/h1-10H |
| InChIKey | XCDVPRVPYCYVKF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.21 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4,5-diphenylselenadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-diphenylselenadiazole?
The IUPAC name of 4,5-diphenylselenadiazole (CID 11161930) is 4,5-diphenylselenadiazole.
What is the SMILES notation for 4,5-diphenylselenadiazole?
The canonical SMILES for 4,5-diphenylselenadiazole is c1ccc(-c2nn[se]c2-c2ccccc2)cc1.
What is the InChIKey of 4,5-diphenylselenadiazole?
The InChIKey is XCDVPRVPYCYVKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2Se/c1-3-7-11(8-4-1)13-14(17-16-15-13)12-9-5-2-6-10-12/h1-10H.
What are the key properties of 4,5-diphenylselenadiazole?
4,5-diphenylselenadiazole has a molecular weight of 285.21 g/mol, XLogP of 2.87, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-diphenylselenadiazole is sourced from PubChem (CID 11161930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).