C10H8N2Se — CID 3011112
4,5-dihydrobenzo[e][1,2,3]benzoselenadiazole (PubChem CID 3011112) has the molecular formula C10H8N2Se and a molecular weight of 235.15 g/mol. Its IUPAC name is 4,5-dihydrobenzo[e][1,2,3]benzoselenadiazole.
| Compound Name | 4,5-dihydrobenzo[e][1,2,3]benzoselenadiazole |
|---|---|
| PubChem CID | 3011112 |
| Molecular Formula | C10H8N2Se |
| Molecular Weight | 235.15 g/mol |
| Exact Mass | 235.99 |
| IUPAC Name | 4,5-dihydrobenzo[e][1,2,3]benzoselenadiazole |
| SMILES | c1ccc2c(c1)CCc1[se]nnc1-2 |
| InChI | InChI=1S/C10H8N2Se/c1-2-4-8-7(3-1)5-6-9-10(8)11-12-13-9/h1-4H,5-6H2 |
| InChIKey | ZKWLDQHHFOPPST-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.15 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|