C15H10N2Se — CID 12682367
3-selena-4,5-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7,9,11,14,16-octaene (PubChem CID 12682367) has the molecular formula C15H10N2Se and a molecular weight of 297.22 g/mol. Its IUPAC name is 3-selena-4,5-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7,9,11,14,16-octaene.
| Compound Name | 3-selena-4,5-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7,9,11,14,16-octaene |
|---|---|
| PubChem CID | 12682367 |
| Molecular Formula | C15H10N2Se |
| Molecular Weight | 297.22 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | 3-selena-4,5-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7,9,11,14,16-octaene |
| SMILES | c1ccc2c(c1)Cc1ccccc1-c1[se]nnc1-2 |
| InChI | InChI=1S/C15H10N2Se/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)15-14(12)16-17-18-15/h1-8H,9H2 |
| InChIKey | NGEUWWGCJNQEQW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.22 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|