C10H9N3 — CID 132546523
4,5-dihydro-2H-benzo[e]benzotriazole (PubChem CID 132546523) has the molecular formula C10H9N3 and a molecular weight of 171.20 g/mol. Its IUPAC name is 4,5-dihydro-2H-benzo[e]benzotriazole.
| Compound Name | 4,5-dihydro-2H-benzo[e]benzotriazole |
|---|---|
| PubChem CID | 132546523 |
| Molecular Formula | C10H9N3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 4,5-dihydro-2H-benzo[e]benzotriazole |
| SMILES | c1ccc2c(c1)CCc1n[nH]nc1-2 |
| InChI | InChI=1S/C10H9N3/c1-2-4-8-7(3-1)5-6-9-10(8)12-13-11-9/h1-4H,5-6H2,(H,11,12,13) |
| InChIKey | ROXJWNCRLLSFLA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |