C18H14N2Se — CID 15402125
5,7-diphenyl-6,7-dihydro-1,2,3-benzoselenadiazole (PubChem CID 15402125) has the molecular formula C18H14N2Se and a molecular weight of 337.28 g/mol. Its IUPAC name is 5,7-diphenyl-6,7-dihydro-1,2,3-benzoselenadiazole.
| Compound Name | 5,7-diphenyl-6,7-dihydro-1,2,3-benzoselenadiazole |
|---|---|
| PubChem CID | 15402125 |
| Molecular Formula | C18H14N2Se |
| Molecular Weight | 337.28 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 5,7-diphenyl-6,7-dihydro-1,2,3-benzoselenadiazole |
| SMILES | C1=C(c2ccccc2)CC(c2ccccc2)c2[se]nnc21 |
| InChI | InChI=1S/C18H14N2Se/c1-3-7-13(8-4-1)15-11-16(14-9-5-2-6-10-14)18-17(12-15)19-20-21-18/h1-10,12,16H,11H2 |
| InChIKey | DFPVUZCMHMLKAO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.28 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|