C21H18N4Se2 — CID 56678503
(4S)-4-[(R)-phenyl-(4-phenylselenadiazol-5-yl)methyl]-4,5,6,7-tetrahydro-1,2,3-benzoselenadiazole (PubChem CID 56678503) has the molecular formula C21H18N4Se2 and a molecular weight of 484.32 g/mol. Its IUPAC name is (4S)-4-[(R)-phenyl-(4-phenylselenadiazol-5-yl)methyl]-4,5,6,7-tetrahydro-1,2,3-benzoselenadiazole.
| Compound Name | (4S)-4-[(R)-phenyl-(4-phenylselenadiazol-5-yl)methyl]-4,5,6,7-tetrahydro-1,2,3-benzoselenadiazole |
|---|---|
| PubChem CID | 56678503 |
| Molecular Formula | C21H18N4Se2 |
| Molecular Weight | 484.32 g/mol |
| Exact Mass | 485.99 |
| IUPAC Name | (4S)-4-[(R)-phenyl-(4-phenylselenadiazol-5-yl)methyl]-4,5,6,7-tetrahydro-1,2,3-benzoselenadiazole |
| SMILES | c1ccc(-c2nn[se]c2[C@@H](c2ccccc2)[C@@H]2CCCc3[se]nnc32)cc1 |
| InChI | InChI=1S/C21H18N4Se2/c1-3-8-14(9-4-1)18(16-12-7-13-17-20(16)23-24-26-17)21-19(22-25-27-21)15-10-5-2-6-11-15/h1-6,8-11,16,18H,7,12-13H2/t16-,18-/m0/s1 |
| InChIKey | NEONOHOWAJXFBC-WMZOPIPTSA-N |
| XLogP | 3.30 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|