C18H17NSe — CID 141036767
4-phenyl-3-(3-phenylpropyl)-1,2-selenazole (PubChem CID 141036767) has the molecular formula C18H17NSe and a molecular weight of 326.30 g/mol. Its IUPAC name is 4-phenyl-3-(3-phenylpropyl)-1,2-selenazole.
| Compound Name | 4-phenyl-3-(3-phenylpropyl)-1,2-selenazole |
|---|---|
| PubChem CID | 141036767 |
| Molecular Formula | C18H17NSe |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | 4-phenyl-3-(3-phenylpropyl)-1,2-selenazole |
| SMILES | c1ccc(CCCc2n[se]cc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H17NSe/c1-3-8-15(9-4-1)10-7-13-18-17(14-20-19-18)16-11-5-2-6-12-16/h1-6,8-9,11-12,14H,7,10,13H2 |
| InChIKey | LHTJIIFIWASHPJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|