C13H12FNSe — CID 153406931
3-(4-fluorophenyl)-4,5,6,7-tetrahydro-1,2-benzoselenazole (PubChem CID 153406931) has the molecular formula C13H12FNSe and a molecular weight of 280.20 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-4,5,6,7-tetrahydro-1,2-benzoselenazole.
| Compound Name | 3-(4-fluorophenyl)-4,5,6,7-tetrahydro-1,2-benzoselenazole |
|---|---|
| PubChem CID | 153406931 |
| Molecular Formula | C13H12FNSe |
| Molecular Weight | 280.20 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | 3-(4-fluorophenyl)-4,5,6,7-tetrahydro-1,2-benzoselenazole |
| SMILES | Fc1ccc(-c2n[se]c3c2CCCC3)cc1 |
| InChI | InChI=1S/C13H12FNSe/c14-10-7-5-9(6-8-10)13-11-3-1-2-4-12(11)16-15-13/h5-8H,1-4H2 |
| InChIKey | LGCOGGTYEICSPL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.20 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|