C18H17NSe — CID 153406895
4,5-diphenyl-3-propyl-1,2-selenazole (PubChem CID 153406895) has the molecular formula C18H17NSe and a molecular weight of 326.30 g/mol. Its IUPAC name is 4,5-diphenyl-3-propyl-1,2-selenazole.
| Compound Name | 4,5-diphenyl-3-propyl-1,2-selenazole |
|---|---|
| PubChem CID | 153406895 |
| Molecular Formula | C18H17NSe |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | 4,5-diphenyl-3-propyl-1,2-selenazole |
| SMILES | CCCc1n[se]c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C18H17NSe/c1-2-9-16-17(14-10-5-3-6-11-14)18(20-19-16)15-12-7-4-8-13-15/h3-8,10-13H,2,9H2,1H3 |
| InChIKey | JLWVQZCYHGOYCY-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|