C16H14N2Se — CID 151578564
4,5-bis(4-methylphenyl)selenadiazole (PubChem CID 151578564) has the molecular formula C16H14N2Se and a molecular weight of 313.26 g/mol. Its IUPAC name is 4,5-bis(4-methylphenyl)selenadiazole.
| Compound Name | 4,5-bis(4-methylphenyl)selenadiazole |
|---|---|
| PubChem CID | 151578564 |
| Molecular Formula | C16H14N2Se |
| Molecular Weight | 313.26 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 4,5-bis(4-methylphenyl)selenadiazole |
| SMILES | Cc1ccc(-c2nn[se]c2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C16H14N2Se/c1-11-3-7-13(8-4-11)15-16(19-18-17-15)14-9-5-12(2)6-10-14/h3-10H,1-2H3 |
| InChIKey | QFZGXKNUAPYMCU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.26 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|