C3H7N5O6 — CID 139083417
3-amino-1H-1,2,4-triazol-4-ium-5-carboxylic acid;nitrate;hydrate (PubChem CID 139083417) has the molecular formula C3H7N5O6 and a molecular weight of 209.12 g/mol. Its IUPAC name is 3-amino-1H-1,2,4-triazol-4-ium-5-carboxylic acid;nitrate;hydrate.
| Compound Name | 3-amino-1H-1,2,4-triazol-4-ium-5-carboxylic acid;nitrate;hydrate |
|---|---|
| PubChem CID | 139083417 |
| Molecular Formula | C3H7N5O6 |
| Molecular Weight | 209.12 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | 3-amino-1H-1,2,4-triazol-4-ium-5-carboxylic acid;nitrate;hydrate |
| SMILES | Nc1n[nH]c(C(=O)O)[nH+]1.O.O=[N+]([O-])[O-] |
| InChI | InChI=1S/C3H4N4O2.NO3.H2O/c4-3-5-1(2(8)9)6-7-3;2-1(3)4;/h(H,8,9)(H3,4,5,6,7);;1H2/q;-1;/p+1 |
| InChIKey | IAJPJMIFLFEPQV-UHFFFAOYSA-O |
| XLogP | -2.56 |
| TPSA | 203.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.12 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|