C33H32N4O7 — CID 139083427
1-benzhydryl-4-[(E)-3-phenylprop-2-enyl]piperazin-4-ium;2-carboxy-4,6-dinitrophenolate (PubChem CID 139083427) has the molecular formula C33H32N4O7 and a molecular weight of 596.64 g/mol. Its IUPAC name is 1-benzhydryl-4-[(E)-3-phenylprop-2-enyl]piperazin-4-ium;2-carboxy-4,6-dinitrophenolate.
| Compound Name | 1-benzhydryl-4-[(E)-3-phenylprop-2-enyl]piperazin-4-ium;2-carboxy-4,6-dinitrophenolate |
|---|---|
| PubChem CID | 139083427 |
| Molecular Formula | C33H32N4O7 |
| Molecular Weight | 596.64 g/mol |
| Exact Mass | 596.23 |
| IUPAC Name | 1-benzhydryl-4-[(E)-3-phenylprop-2-enyl]piperazin-4-ium;2-carboxy-4,6-dinitrophenolate |
| SMILES | C(=C/c1ccccc1)\C[NH+]1CCN(C(c2ccccc2)c2ccccc2)CC1.O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1[O-] |
| InChI | InChI=1S/C26H28N2.C7H4N2O7/c1-4-11-23(12-5-1)13-10-18-27-19-21-28(22-20-27)26(24-14-6-2-7-15-24)25-16-8-3-9-17-25;10-6-4(7(11)12)1-3(8(13)14)2-5(6)9(15)16/h1-17,26H,18-22H2;1-2,10H,(H,11,12)/b13-10+; |
| InChIKey | WFIYXVGIDVDONE-RSGUCCNWSA-N |
| XLogP | 3.96 |
| TPSA | 154.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.64 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|