C20H24N3O3+ — CID 7444276
4-nitro-2-[[4-[(E)-3-phenylprop-2-enyl]piperazine-1,4-diium-1-yl]methyl]phenolate (PubChem CID 7444276) has the molecular formula C20H24N3O3+ and a molecular weight of 354.43 g/mol. Its IUPAC name is 4-nitro-2-[[4-[(E)-3-phenylprop-2-enyl]piperazine-1,4-diium-1-yl]methyl]phenolate.
| Compound Name | 4-nitro-2-[[4-[(E)-3-phenylprop-2-enyl]piperazine-1,4-diium-1-yl]methyl]phenolate |
|---|---|
| PubChem CID | 7444276 |
| Molecular Formula | C20H24N3O3+ |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 4-nitro-2-[[4-[(E)-3-phenylprop-2-enyl]piperazine-1,4-diium-1-yl]methyl]phenolate |
| SMILES | O=[N+]([O-])c1ccc([O-])c(C[NH+]2CC[NH+](C/C=C/c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C20H23N3O3/c24-20-9-8-19(23(25)26)15-18(20)16-22-13-11-21(12-14-22)10-4-7-17-5-2-1-3-6-17/h1-9,15,24H,10-14,16H2/p+1/b7-4+ |
| InChIKey | OMTZPYLPOIPAFK-QPJJXVBHSA-O |
| XLogP | -0.33 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|