C18H22N2O3 — CID 139085173
1-[(4S,5R,6S)-6-hydroxy-4-(4-methoxyphenyl)-3,6-dimethyl-2,4,5,7-tetrahydroindazol-5-yl]ethanone (PubChem CID 139085173) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is 1-[(4S,5R,6S)-6-hydroxy-4-(4-methoxyphenyl)-3,6-dimethyl-2,4,5,7-tetrahydroindazol-5-yl]ethanone.
| Compound Name | 1-[(4S,5R,6S)-6-hydroxy-4-(4-methoxyphenyl)-3,6-dimethyl-2,4,5,7-tetrahydroindazol-5-yl]ethanone |
|---|---|
| PubChem CID | 139085173 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 1-[(4S,5R,6S)-6-hydroxy-4-(4-methoxyphenyl)-3,6-dimethyl-2,4,5,7-tetrahydroindazol-5-yl]ethanone |
| SMILES | COc1ccc([C@H]2c3c(n[nH]c3C)C[C@](C)(O)[C@@H]2C(C)=O)cc1 |
| InChI | InChI=1S/C18H22N2O3/c1-10-15-14(20-19-10)9-18(3,22)17(11(2)21)16(15)12-5-7-13(23-4)8-6-12/h5-8,16-17,22H,9H2,1-4H3,(H,19,20)/t16-,17+,18-/m0/s1 |
| InChIKey | ZDLGDZFLNPOCFN-KSZLIROESA-N |
| XLogP | 2.37 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |