C15H11Cl2NOS — CID 139085756
(Z)-3-(2,4-dichlorophenyl)-3-hydroxy-N-phenylprop-2-enethioamide (PubChem CID 139085756) has the molecular formula C15H11Cl2NOS and a molecular weight of 324.23 g/mol. Its IUPAC name is (Z)-3-(2,4-dichlorophenyl)-3-hydroxy-N-phenylprop-2-enethioamide.
| Compound Name | (Z)-3-(2,4-dichlorophenyl)-3-hydroxy-N-phenylprop-2-enethioamide |
|---|---|
| PubChem CID | 139085756 |
| Molecular Formula | C15H11Cl2NOS |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 322.99 |
| IUPAC Name | (Z)-3-(2,4-dichlorophenyl)-3-hydroxy-N-phenylprop-2-enethioamide |
| SMILES | O/C(=C\C(=S)Nc1ccccc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H11Cl2NOS/c16-10-6-7-12(13(17)8-10)14(19)9-15(20)18-11-4-2-1-3-5-11/h1-9,19H,(H,18,20)/b14-9- |
| InChIKey | UBHDLIRFESISBD-ZROIWOOFSA-N |
| XLogP | 5.33 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|