About (Z)-3-(2,4-dichlorophenyl)-3-hydroxy-N-phenylprop-2-enethioamide
(Z)-3-(2,4-dichlorophenyl)-3-hydroxy-N-phenylprop-2-enethioamide (PubChem CID 139085756) has the molecular formula C15H11Cl2NOS
and a molecular weight of 324.23 g/mol. Its IUPAC name is (Z)-3-(2,4-dichlorophenyl)-3-hydroxy-N-phenylprop-2-enethioamide.
Molecular Properties
| Compound Name | (Z)-3-(2,4-dichlorophenyl)-3-hydroxy-N-phenylprop-2-enethioamide |
| PubChem CID | 139085756 |
| Molecular Formula | C15H11Cl2NOS |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 322.99 |
| IUPAC Name | (Z)-3-(2,4-dichlorophenyl)-3-hydroxy-N-phenylprop-2-enethioamide |
| SMILES | O/C(=C\C(=S)Nc1ccccc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H11Cl2NOS/c16-10-6-7-12(13(17)8-10)14(19)9-15(20)18-11-4-2-1-3-5-11/h1-9,19H,(H,18,20)/b14-9- |
| InChIKey | UBHDLIRFESISBD-ZROIWOOFSA-N |
| XLogP | 5.33 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-(2,4-dichlorophenyl)-3-hydroxy-N-phenylprop-2-enethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-(2,4-dichlorophenyl)-3-hydroxy-N-phenylprop-2-enethioamide?
The IUPAC name of (Z)-3-(2,4-dichlorophenyl)-3-hydroxy-N-phenylprop-2-enethioamide (CID 139085756) is (Z)-3-(2,4-dichlorophenyl)-3-hydroxy-N-phenylprop-2-enethioamide.
What is the SMILES notation for (Z)-3-(2,4-dichlorophenyl)-3-hydroxy-N-phenylprop-2-enethioamide?
The canonical SMILES for (Z)-3-(2,4-dichlorophenyl)-3-hydroxy-N-phenylprop-2-enethioamide is O/C(=C\C(=S)Nc1ccccc1)c1ccc(Cl)cc1Cl.
What is the InChIKey of (Z)-3-(2,4-dichlorophenyl)-3-hydroxy-N-phenylprop-2-enethioamide?
The InChIKey is UBHDLIRFESISBD-ZROIWOOFSA-N. The full InChI is InChI=1S/C15H11Cl2NOS/c16-10-6-7-12(13(17)8-10)14(19)9-15(20)18-11-4-2-1-3-5-11/h1-9,19H,(H,18,20)/b14-9-.
What are the key properties of (Z)-3-(2,4-dichlorophenyl)-3-hydroxy-N-phenylprop-2-enethioamide?
(Z)-3-(2,4-dichlorophenyl)-3-hydroxy-N-phenylprop-2-enethioamide has a molecular weight of 324.23 g/mol, XLogP of 5.33, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-(2,4-dichlorophenyl)-3-hydroxy-N-phenylprop-2-enethioamide is sourced from PubChem (CID 139085756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).