About 2,4-dibromo-1,3-dihydroxyxanthen-9-one
2,4-dibromo-1,3-dihydroxyxanthen-9-one (PubChem CID 139085816) has the molecular formula C13H6Br2O4
and a molecular weight of 386.00 g/mol. Its IUPAC name is 2,4-dibromo-1,3-dihydroxyxanthen-9-one.
Molecular Properties
| Compound Name | 2,4-dibromo-1,3-dihydroxyxanthen-9-one |
| PubChem CID | 139085816 |
| Molecular Formula | C13H6Br2O4 |
| Molecular Weight | 386.00 g/mol |
| Exact Mass | 383.86 |
| IUPAC Name | 2,4-dibromo-1,3-dihydroxyxanthen-9-one |
| SMILES | O=c1c2ccccc2oc2c(Br)c(O)c(Br)c(O)c12 |
| InChI | InChI=1S/C13H6Br2O4/c14-8-11(17)7-10(16)5-3-1-2-4-6(5)19-13(7)9(15)12(8)18/h1-4,17-18H |
| InChIKey | JCQNWZIQWHXWMM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.00 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dibromo-1,3-dihydroxyxanthen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dibromo-1,3-dihydroxyxanthen-9-one?
The IUPAC name of 2,4-dibromo-1,3-dihydroxyxanthen-9-one (CID 139085816) is 2,4-dibromo-1,3-dihydroxyxanthen-9-one.
What is the SMILES notation for 2,4-dibromo-1,3-dihydroxyxanthen-9-one?
The canonical SMILES for 2,4-dibromo-1,3-dihydroxyxanthen-9-one is O=c1c2ccccc2oc2c(Br)c(O)c(Br)c(O)c12.
What is the InChIKey of 2,4-dibromo-1,3-dihydroxyxanthen-9-one?
The InChIKey is JCQNWZIQWHXWMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H6Br2O4/c14-8-11(17)7-10(16)5-3-1-2-4-6(5)19-13(7)9(15)12(8)18/h1-4,17-18H.
What are the key properties of 2,4-dibromo-1,3-dihydroxyxanthen-9-one?
2,4-dibromo-1,3-dihydroxyxanthen-9-one has a molecular weight of 386.00 g/mol, XLogP of 3.88, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dibromo-1,3-dihydroxyxanthen-9-one is sourced from PubChem (CID 139085816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).