C26H15BrO4 — CID 142377521
1-(10-bromoanthracen-9-yl)dibenzofuran-2,3,4-triol (PubChem CID 142377521) has the molecular formula C26H15BrO4 and a molecular weight of 471.31 g/mol. Its IUPAC name is 1-(10-bromoanthracen-9-yl)dibenzofuran-2,3,4-triol.
| Compound Name | 1-(10-bromoanthracen-9-yl)dibenzofuran-2,3,4-triol |
|---|---|
| PubChem CID | 142377521 |
| Molecular Formula | C26H15BrO4 |
| Molecular Weight | 471.31 g/mol |
| Exact Mass | 470.02 |
| IUPAC Name | 1-(10-bromoanthracen-9-yl)dibenzofuran-2,3,4-triol |
| SMILES | Oc1c(O)c(-c2c3ccccc3c(Br)c3ccccc23)c2c(oc3ccccc32)c1O |
| InChI | InChI=1S/C26H15BrO4/c27-22-15-9-3-1-7-13(15)19(14-8-2-4-10-16(14)22)21-20-17-11-5-6-12-18(17)31-26(20)25(30)24(29)23(21)28/h1-12,28-30H |
| InChIKey | LQNGTMVRVBHWSJ-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.31 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|