C30H32N2O6 — CID 139087731
bis(4-ethoxybenzoic acid);4-(2-pyridin-4-ylethyl)pyridine (PubChem CID 139087731) has the molecular formula C30H32N2O6 and a molecular weight of 516.59 g/mol. Its IUPAC name is bis(4-ethoxybenzoic acid);4-(2-pyridin-4-ylethyl)pyridine.
| Compound Name | bis(4-ethoxybenzoic acid);4-(2-pyridin-4-ylethyl)pyridine |
|---|---|
| PubChem CID | 139087731 |
| Molecular Formula | C30H32N2O6 |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | bis(4-ethoxybenzoic acid);4-(2-pyridin-4-ylethyl)pyridine |
| SMILES | CCOc1ccc(C(=O)O)cc1.CCOc1ccc(C(=O)O)cc1.c1cc(CCc2ccncc2)ccn1 |
| InChI | InChI=1S/C12H12N2.2C9H10O3/c1(11-3-7-13-8-4-11)2-12-5-9-14-10-6-12;2*1-2-12-8-5-3-7(4-6-8)9(10)11/h3-10H,1-2H2;2*3-6H,2H2,1H3,(H,10,11) |
| InChIKey | PRJZWFGUWNPRKV-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 118.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |