C34H40N2O6 — CID 139087733
bis(4-butoxybenzoic acid);4-(2-pyridin-4-ylethyl)pyridine (PubChem CID 139087733) has the molecular formula C34H40N2O6 and a molecular weight of 572.70 g/mol. Its IUPAC name is bis(4-butoxybenzoic acid);4-(2-pyridin-4-ylethyl)pyridine.
| Compound Name | bis(4-butoxybenzoic acid);4-(2-pyridin-4-ylethyl)pyridine |
|---|---|
| PubChem CID | 139087733 |
| Molecular Formula | C34H40N2O6 |
| Molecular Weight | 572.70 g/mol |
| Exact Mass | 572.29 |
| IUPAC Name | bis(4-butoxybenzoic acid);4-(2-pyridin-4-ylethyl)pyridine |
| SMILES | CCCCOc1ccc(C(=O)O)cc1.CCCCOc1ccc(C(=O)O)cc1.c1cc(CCc2ccncc2)ccn1 |
| InChI | InChI=1S/C12H12N2.2C11H14O3/c1(11-3-7-13-8-4-11)2-12-5-9-14-10-6-12;2*1-2-3-8-14-10-6-4-9(5-7-10)11(12)13/h3-10H,1-2H2;2*4-7H,2-3,8H2,1H3,(H,12,13) |
| InChIKey | IEMMIROGTVHRDU-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 118.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.70 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|