C16H9BrN2O4 — CID 139088018
4-(4-bromo-2,5-dimethoxyphenyl)-3,6-dioxocyclohexa-1,4-diene-1,2-dicarbonitrile (PubChem CID 139088018) has the molecular formula C16H9BrN2O4 and a molecular weight of 373.16 g/mol. Its IUPAC name is 4-(4-bromo-2,5-dimethoxyphenyl)-3,6-dioxocyclohexa-1,4-diene-1,2-dicarbonitrile.
| Compound Name | 4-(4-bromo-2,5-dimethoxyphenyl)-3,6-dioxocyclohexa-1,4-diene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 139088018 |
| Molecular Formula | C16H9BrN2O4 |
| Molecular Weight | 373.16 g/mol |
| Exact Mass | 371.97 |
| IUPAC Name | 4-(4-bromo-2,5-dimethoxyphenyl)-3,6-dioxocyclohexa-1,4-diene-1,2-dicarbonitrile |
| SMILES | COc1cc(C2=CC(=O)C(C#N)=C(C#N)C2=O)c(OC)cc1Br |
| InChI | InChI=1S/C16H9BrN2O4/c1-22-14-5-12(17)15(23-2)4-8(14)9-3-13(20)10(6-18)11(7-19)16(9)21/h3-5H,1-2H3 |
| InChIKey | JNOYQALAXKRFQB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.16 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|